C7H8N4S2 — CID 82428071
5-(4-ethyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82428071) has the molecular formula C7H8N4S2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-(4-ethyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-ethyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82428071 |
| Molecular Formula | C7H8N4S2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5-(4-ethyl-1,3-thiazol-5-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCc1ncsc1-c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C7H8N4S2/c1-2-4-5(13-3-8-4)6-9-7(12)11-10-6/h3H,2H2,1H3,(H2,9,10,11,12) |
| InChIKey | STTIDHOGTIVOLL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|