C17H24N2OS — CID 82430111
2-[4-ethyl-2-(4-propoxyphenyl)-1,3-thiazol-5-yl]propan-2-amine (PubChem CID 82430111) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-[4-ethyl-2-(4-propoxyphenyl)-1,3-thiazol-5-yl]propan-2-amine.
| Compound Name | 2-[4-ethyl-2-(4-propoxyphenyl)-1,3-thiazol-5-yl]propan-2-amine |
|---|---|
| PubChem CID | 82430111 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[4-ethyl-2-(4-propoxyphenyl)-1,3-thiazol-5-yl]propan-2-amine |
| SMILES | CCCOc1ccc(-c2nc(CC)c(C(C)(C)N)s2)cc1 |
| InChI | InChI=1S/C17H24N2OS/c1-5-11-20-13-9-7-12(8-10-13)16-19-14(6-2)15(21-16)17(3,4)18/h7-10H,5-6,11,18H2,1-4H3 |
| InChIKey | GZXDHNAADIQUCR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |