C16H18N2O2S — CID 82430209
2-(3,4-diethoxyphenyl)-4-ethyl-1,3-thiazole-5-carbonitrile (PubChem CID 82430209) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-4-ethyl-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-(3,4-diethoxyphenyl)-4-ethyl-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82430209 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-4-ethyl-1,3-thiazole-5-carbonitrile |
| SMILES | CCOc1ccc(-c2nc(CC)c(C#N)s2)cc1OCC |
| InChI | InChI=1S/C16H18N2O2S/c1-4-12-15(10-17)21-16(18-12)11-7-8-13(19-5-2)14(9-11)20-6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | XFVFXABSAJGIOX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |