C17H31N3S — CID 82430727
N-[[4-ethyl-2-[2-(2-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 82430727) has the molecular formula C17H31N3S and a molecular weight of 309.52 g/mol. Its IUPAC name is N-[[4-ethyl-2-[2-(2-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-ethyl-2-[2-(2-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82430727 |
| Molecular Formula | C17H31N3S |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N-[[4-ethyl-2-[2-(2-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(CCN2CCCCC2C)nc1CC |
| InChI | InChI=1S/C17H31N3S/c1-4-10-18-13-16-15(5-2)19-17(21-16)9-12-20-11-7-6-8-14(20)3/h14,18H,4-13H2,1-3H3 |
| InChIKey | NXSYLFOXZFLQIW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|