C12H18N2O3S — CID 82431077
3-(4-ethyl-2-morpholin-4-yl-1,3-thiazol-5-yl)propanoic acid (PubChem CID 82431077) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-(4-ethyl-2-morpholin-4-yl-1,3-thiazol-5-yl)propanoic acid.
| Compound Name | 3-(4-ethyl-2-morpholin-4-yl-1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 82431077 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-(4-ethyl-2-morpholin-4-yl-1,3-thiazol-5-yl)propanoic acid |
| SMILES | CCc1nc(N2CCOCC2)sc1CCC(=O)O |
| InChI | InChI=1S/C12H18N2O3S/c1-2-9-10(3-4-11(15)16)18-12(13-9)14-5-7-17-8-6-14/h2-8H2,1H3,(H,15,16) |
| InChIKey | XZKLJLSUHAEHKA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |