About 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine
4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine (PubChem CID 82431258) has the molecular formula C13H19N3S2
and a molecular weight of 281.45 g/mol. Its IUPAC name is 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine |
| PubChem CID | 82431258 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1nc(-c2sc(C)nc2CCC)cs1 |
| InChI | InChI=1S/C13H19N3S2/c1-4-6-10-12(18-9(3)15-10)11-8-17-13(16-11)14-7-5-2/h8H,4-7H2,1-3H3,(H,14,16) |
| InChIKey | IIUBTCVYYZQLFS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine?
The IUPAC name of 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine (CID 82431258) is 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine is CCCNc1nc(-c2sc(C)nc2CCC)cs1.
What is the InChIKey of 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine?
The InChIKey is IIUBTCVYYZQLFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3S2/c1-4-6-10-12(18-9(3)15-10)11-8-17-13(16-11)14-7-5-2/h8H,4-7H2,1-3H3,(H,14,16).
What are the key properties of 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine?
4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine has a molecular weight of 281.45 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-4-propyl-1,3-thiazol-5-yl)-N-propyl-1,3-thiazol-2-amine is sourced from PubChem (CID 82431258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).