2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid

C11H17NO3S — CID 82431442

IUPAC2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid
SMILESCCCc1nc(CCOC)sc1CC(=O)O
InChIInChI=1S/C11H17NO3S/c1-3-4-8-9(7-11(13)14)16-10(12-8)5-6-15-2/h3-7H2,1-2H3,(H,13,14)
InChIKeyCZTADBGGHOVCLH-UHFFFAOYSA-N
MW243.33 g/mol
LogP1.91
Rot. Bonds7

About 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid

2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 82431442) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid
PubChem CID82431442
Molecular FormulaC11H17NO3S
Molecular Weight243.33 g/mol
Exact Mass243.09
IUPAC Name2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid
SMILESCCCc1nc(CCOC)sc1CC(=O)O
InChIInChI=1S/C11H17NO3S/c1-3-4-8-9(7-11(13)14)16-10(12-8)5-6-15-2/h3-7H2,1-2H3,(H,13,14)
InChIKeyCZTADBGGHOVCLH-UHFFFAOYSA-N
XLogP1.91
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.33
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid (CID 82431442) is 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid is CCCc1nc(CCOC)sc1CC(=O)O.
What is the InChIKey of 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid?
The InChIKey is CZTADBGGHOVCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3S/c1-3-4-8-9(7-11(13)14)16-10(12-8)5-6-15-2/h3-7H2,1-2H3,(H,13,14).
What are the key properties of 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid?
2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid has a molecular weight of 243.33 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethyl)-4-propyl-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 82431442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).