C10H16BrNOS — CID 82433749
5-(bromomethyl)-2-(2-methoxyethyl)-4-propan-2-yl-1,3-thiazole (PubChem CID 82433749) has the molecular formula C10H16BrNOS and a molecular weight of 278.22 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2-methoxyethyl)-4-propan-2-yl-1,3-thiazole.
| Compound Name | 5-(bromomethyl)-2-(2-methoxyethyl)-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 82433749 |
| Molecular Formula | C10H16BrNOS |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5-(bromomethyl)-2-(2-methoxyethyl)-4-propan-2-yl-1,3-thiazole |
| SMILES | COCCc1nc(C(C)C)c(CBr)s1 |
| InChI | InChI=1S/C10H16BrNOS/c1-7(2)10-8(6-11)14-9(12-10)4-5-13-3/h7H,4-6H2,1-3H3 |
| InChIKey | UTZLZSPPBDCHJH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|