C13H21NOS — CID 82434692
(2-cyclohexyl-4-propan-2-yl-1,3-thiazol-5-yl)methanol (PubChem CID 82434692) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is (2-cyclohexyl-4-propan-2-yl-1,3-thiazol-5-yl)methanol.
| Compound Name | (2-cyclohexyl-4-propan-2-yl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 82434692 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2-cyclohexyl-4-propan-2-yl-1,3-thiazol-5-yl)methanol |
| SMILES | CC(C)c1nc(C2CCCCC2)sc1CO |
| InChI | InChI=1S/C13H21NOS/c1-9(2)12-11(8-15)16-13(14-12)10-6-4-3-5-7-10/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | NWLCCIJPCXKEOX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |