C12H16N4OS2 — CID 82435855
3-(4-cyclopropyl-2-methyl-1,3-thiazol-5-yl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 82435855) has the molecular formula C12H16N4OS2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 3-(4-cyclopropyl-2-methyl-1,3-thiazol-5-yl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-cyclopropyl-2-methyl-1,3-thiazol-5-yl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82435855 |
| Molecular Formula | C12H16N4OS2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(4-cyclopropyl-2-methyl-1,3-thiazol-5-yl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COCCn1c(-c2sc(C)nc2C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C12H16N4OS2/c1-7-13-9(8-3-4-8)10(19-7)11-14-15-12(18)16(11)5-6-17-2/h8H,3-6H2,1-2H3,(H,15,18) |
| InChIKey | NNXHNSBOGXYVIL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|