C14H14N2S2 — CID 82435946
4-cyclopropyl-2-(2-methylphenyl)-1,3-thiazole-5-carbothioamide (PubChem CID 82435946) has the molecular formula C14H14N2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-cyclopropyl-2-(2-methylphenyl)-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-cyclopropyl-2-(2-methylphenyl)-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82435946 |
| Molecular Formula | C14H14N2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-cyclopropyl-2-(2-methylphenyl)-1,3-thiazole-5-carbothioamide |
| SMILES | Cc1ccccc1-c1nc(C2CC2)c(C(N)=S)s1 |
| InChI | InChI=1S/C14H14N2S2/c1-8-4-2-3-5-10(8)14-16-11(9-6-7-9)12(18-14)13(15)17/h2-5,9H,6-7H2,1H3,(H2,15,17) |
| InChIKey | DRLBSHZDUZMZNI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|