C15H20N2O2S — CID 82438064
(E)-3-[4-cyclopropyl-2-(4-methylpiperidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82438064) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is (E)-3-[4-cyclopropyl-2-(4-methylpiperidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-cyclopropyl-2-(4-methylpiperidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82438064 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (E)-3-[4-cyclopropyl-2-(4-methylpiperidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CC1CCN(c2nc(C3CC3)c(/C=C/C(=O)O)s2)CC1 |
| InChI | InChI=1S/C15H20N2O2S/c1-10-6-8-17(9-7-10)15-16-14(11-2-3-11)12(20-15)4-5-13(18)19/h4-5,10-11H,2-3,6-9H2,1H3,(H,18,19)/b5-4+ |
| InChIKey | UNOBMJQYSSRHJH-SNAWJCMRSA-N |
| XLogP | 3.35 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|