C14H22N2O2S — CID 82439507
(E)-3-[4-tert-butyl-2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82439507) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is (E)-3-[4-tert-butyl-2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-tert-butyl-2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82439507 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (E)-3-[4-tert-butyl-2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CN(C)CCc1nc(C(C)(C)C)c(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C14H22N2O2S/c1-14(2,3)13-10(6-7-12(17)18)19-11(15-13)8-9-16(4)5/h6-7H,8-9H2,1-5H3,(H,17,18)/b7-6+ |
| InChIKey | UKJSVSFAQBDXDF-VOTSOKGWSA-N |
| XLogP | 2.64 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|