C15H15NO3S — CID 82440093
(E)-3-[2-benzyl-4-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82440093) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is (E)-3-[2-benzyl-4-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-benzyl-4-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82440093 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (E)-3-[2-benzyl-4-(methoxymethyl)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | COCc1nc(Cc2ccccc2)sc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H15NO3S/c1-19-10-12-13(7-8-15(17)18)20-14(16-12)9-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3,(H,17,18)/b8-7+ |
| InChIKey | UMYWNDULKIJVJZ-BQYQJAHWSA-N |
| XLogP | 2.98 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|