C16H9NO2 — CID 824419
14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione (PubChem CID 824419) has the molecular formula C16H9NO2 and a molecular weight of 247.25 g/mol. Its IUPAC name is 14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione.
| Compound Name | 14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
|---|---|
| PubChem CID | 824419 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
| SMILES | O=C1c2ccccc2-c2cc(=O)[nH]c3cccc1c23 |
| InChI | InChI=1S/C16H9NO2/c18-14-8-12-9-4-1-2-5-10(9)16(19)11-6-3-7-13(17-14)15(11)12/h1-8H,(H,17,18) |
| InChIKey | CTSKAPUYEZZYQA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |