C10H16N4O3S — CID 82441963
4-(methoxymethyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 82441963) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-(methoxymethyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 82441963 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-(methoxymethyl)-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | COCc1nc(N2CCOCC2)sc1C(=O)NN |
| InChI | InChI=1S/C10H16N4O3S/c1-16-6-7-8(9(15)13-11)18-10(12-7)14-2-4-17-5-3-14/h2-6,11H2,1H3,(H,13,15) |
| InChIKey | NLNARUPBHPFOGJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|