C14H20N4OS — CID 82441971
N-[[4-(methoxymethyl)-2-pyrazin-2-yl-1,3-thiazol-5-yl]methyl]butan-1-amine (PubChem CID 82441971) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)-2-pyrazin-2-yl-1,3-thiazol-5-yl]methyl]butan-1-amine.
| Compound Name | N-[[4-(methoxymethyl)-2-pyrazin-2-yl-1,3-thiazol-5-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 82441971 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[[4-(methoxymethyl)-2-pyrazin-2-yl-1,3-thiazol-5-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1sc(-c2cnccn2)nc1COC |
| InChI | InChI=1S/C14H20N4OS/c1-3-4-5-15-9-13-12(10-19-2)18-14(20-13)11-8-16-6-7-17-11/h6-8,15H,3-5,9-10H2,1-2H3 |
| InChIKey | VIGMAWALNRUVLD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|