C17H9Cl2NO2 — CID 824422
10,16-dichloro-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione (PubChem CID 824422) has the molecular formula C17H9Cl2NO2 and a molecular weight of 330.17 g/mol. Its IUPAC name is 10,16-dichloro-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 10,16-dichloro-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 824422 |
| Molecular Formula | C17H9Cl2NO2 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 10,16-dichloro-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
| SMILES | Cn1c(=O)c(Cl)c2c3c(c(Cl)ccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H9Cl2NO2/c1-20-11-7-6-10(18)13-14(11)12(15(19)17(20)22)8-4-2-3-5-9(8)16(13)21/h2-7H,1H3 |
| InChIKey | SOOXQTPPXQQCPA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |