About 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one
5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one (PubChem CID 82442590) has the molecular formula C7H7N5OS
and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one |
| PubChem CID | 82442590 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one |
| SMILES | Cc1cc(-c2nnc(N)s2)c(=O)[nH]n1 |
| InChI | InChI=1S/C7H7N5OS/c1-3-2-4(5(13)10-9-3)6-11-12-7(8)14-6/h2H,1H3,(H2,8,12)(H,10,13) |
| InChIKey | LPVNHPRTLPMAME-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one?
The IUPAC name of 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one (CID 82442590) is 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one.
What is the SMILES notation for 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one?
The canonical SMILES for 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one is Cc1cc(-c2nnc(N)s2)c(=O)[nH]n1.
What is the InChIKey of 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one?
The InChIKey is LPVNHPRTLPMAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5OS/c1-3-2-4(5(13)10-9-3)6-11-12-7(8)14-6/h2H,1H3,(H2,8,12)(H,10,13).
What are the key properties of 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one?
5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one has a molecular weight of 209.23 g/mol, XLogP of 0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-1,3,4-thiadiazol-2-yl)-3-methyl-1H-pyridazin-6-one is sourced from PubChem (CID 82442590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).