C9H11F3N2OS — CID 824432
N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 824432) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 824432 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)c1csc(NC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2OS/c1-8(2,3)5-4-16-7(13-5)14-6(15)9(10,11)12/h4H,1-3H3,(H,13,14,15) |
| InChIKey | BVXMUHPPMLZTRL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |