C14H21ClN2O2 — CID 82443676
2-[6-tert-butyl-2-(2-methylpropyl)-3-oxopyridazin-4-yl]acetyl chloride (PubChem CID 82443676) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-[6-tert-butyl-2-(2-methylpropyl)-3-oxopyridazin-4-yl]acetyl chloride.
| Compound Name | 2-[6-tert-butyl-2-(2-methylpropyl)-3-oxopyridazin-4-yl]acetyl chloride |
|---|---|
| PubChem CID | 82443676 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[6-tert-butyl-2-(2-methylpropyl)-3-oxopyridazin-4-yl]acetyl chloride |
| SMILES | CC(C)Cn1nc(C(C)(C)C)cc(CC(=O)Cl)c1=O |
| InChI | InChI=1S/C14H21ClN2O2/c1-9(2)8-17-13(19)10(7-12(15)18)6-11(16-17)14(3,4)5/h6,9H,7-8H2,1-5H3 |
| InChIKey | NMOBRIVPNZUUJR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|