C18H25N3O — CID 82443960
4-(butylaminomethyl)-6-(2,5-dimethylphenyl)-2-methylpyridazin-3-one (PubChem CID 82443960) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-(butylaminomethyl)-6-(2,5-dimethylphenyl)-2-methylpyridazin-3-one.
| Compound Name | 4-(butylaminomethyl)-6-(2,5-dimethylphenyl)-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 82443960 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 4-(butylaminomethyl)-6-(2,5-dimethylphenyl)-2-methylpyridazin-3-one |
| SMILES | CCCCNCc1cc(-c2cc(C)ccc2C)nn(C)c1=O |
| InChI | InChI=1S/C18H25N3O/c1-5-6-9-19-12-15-11-17(20-21(4)18(15)22)16-10-13(2)7-8-14(16)3/h7-8,10-11,19H,5-6,9,12H2,1-4H3 |
| InChIKey | NPKGBBNVZOXJRK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|