C17H23N3O2 — CID 82444307
4-[(butan-2-ylamino)methyl]-6-(4-methoxyphenyl)-2-methylpyridazin-3-one (PubChem CID 82444307) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[(butan-2-ylamino)methyl]-6-(4-methoxyphenyl)-2-methylpyridazin-3-one.
| Compound Name | 4-[(butan-2-ylamino)methyl]-6-(4-methoxyphenyl)-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 82444307 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-[(butan-2-ylamino)methyl]-6-(4-methoxyphenyl)-2-methylpyridazin-3-one |
| SMILES | CCC(C)NCc1cc(-c2ccc(OC)cc2)nn(C)c1=O |
| InChI | InChI=1S/C17H23N3O2/c1-5-12(2)18-11-14-10-16(19-20(3)17(14)21)13-6-8-15(22-4)9-7-13/h6-10,12,18H,5,11H2,1-4H3 |
| InChIKey | OTAGWZCZRXVHKT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |