C16H18N4O2 — CID 82445447
3-(4-methylphenyl)-5-(piperazine-1-carbonyl)-1H-pyridazin-6-one (PubChem CID 82445447) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(piperazine-1-carbonyl)-1H-pyridazin-6-one.
| Compound Name | 3-(4-methylphenyl)-5-(piperazine-1-carbonyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 82445447 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-(4-methylphenyl)-5-(piperazine-1-carbonyl)-1H-pyridazin-6-one |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCNCC3)c(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C16H18N4O2/c1-11-2-4-12(5-3-11)14-10-13(15(21)19-18-14)16(22)20-8-6-17-7-9-20/h2-5,10,17H,6-9H2,1H3,(H,19,21) |
| InChIKey | KJTNFFSOWZUVIS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |