About 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine
4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine (PubChem CID 824460) has the molecular formula C11H11BrN2S
and a molecular weight of 283.19 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine |
| PubChem CID | 824460 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(Br)cc2)n1C |
| InChI | InChI=1S/C11H11BrN2S/c1-13-11-14(2)10(7-15-11)8-3-5-9(12)6-4-8/h3-7H,1-2H3/b13-11- |
| InChIKey | XRLCNXLCPVYFRA-QBFSEMIESA-N |
| XLogP | 3.05 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine?
The IUPAC name of 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine (CID 824460) is 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine.
What is the SMILES notation for 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine?
The canonical SMILES for 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine is C/N=c1\scc(-c2ccc(Br)cc2)n1C.
What is the InChIKey of 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine?
The InChIKey is XRLCNXLCPVYFRA-QBFSEMIESA-N. The full InChI is InChI=1S/C11H11BrN2S/c1-13-11-14(2)10(7-15-11)8-3-5-9(12)6-4-8/h3-7H,1-2H3/b13-11-.
What are the key properties of 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine?
4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine has a molecular weight of 283.19 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-N,3-dimethyl-1,3-thiazol-2-imine is sourced from PubChem (CID 824460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).