C17H23N3O2 — CID 82446845
4-(aminomethyl)-6-(3-propan-2-yloxyphenyl)-2-propylpyridazin-3-one (PubChem CID 82446845) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(3-propan-2-yloxyphenyl)-2-propylpyridazin-3-one.
| Compound Name | 4-(aminomethyl)-6-(3-propan-2-yloxyphenyl)-2-propylpyridazin-3-one |
|---|---|
| PubChem CID | 82446845 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-(aminomethyl)-6-(3-propan-2-yloxyphenyl)-2-propylpyridazin-3-one |
| SMILES | CCCn1nc(-c2cccc(OC(C)C)c2)cc(CN)c1=O |
| InChI | InChI=1S/C17H23N3O2/c1-4-8-20-17(21)14(11-18)10-16(19-20)13-6-5-7-15(9-13)22-12(2)3/h5-7,9-10,12H,4,8,11,18H2,1-3H3 |
| InChIKey | OBRNJJYLNGCNHI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |