C18H22N2O2 — CID 82447084
4-acetyl-2-butyl-6-(2,4-dimethylphenyl)pyridazin-3-one (PubChem CID 82447084) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-acetyl-2-butyl-6-(2,4-dimethylphenyl)pyridazin-3-one.
| Compound Name | 4-acetyl-2-butyl-6-(2,4-dimethylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 82447084 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-acetyl-2-butyl-6-(2,4-dimethylphenyl)pyridazin-3-one |
| SMILES | CCCCn1nc(-c2ccc(C)cc2C)cc(C(C)=O)c1=O |
| InChI | InChI=1S/C18H22N2O2/c1-5-6-9-20-18(22)16(14(4)21)11-17(19-20)15-8-7-12(2)10-13(15)3/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | BYXKYQJKIQABRA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |