C15H18N4O3 — CID 82447618
2-(2-methoxyethyl)-6-(2-methoxyphenyl)-3-oxopyridazine-4-carboximidamide (PubChem CID 82447618) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-6-(2-methoxyphenyl)-3-oxopyridazine-4-carboximidamide.
| Compound Name | 2-(2-methoxyethyl)-6-(2-methoxyphenyl)-3-oxopyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 82447618 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(2-methoxyethyl)-6-(2-methoxyphenyl)-3-oxopyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2ccccc2OC)nn(CCOC)c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-21-8-7-19-15(20)11(14(16)17)9-12(18-19)10-5-3-4-6-13(10)22-2/h3-6,9H,7-8H2,1-2H3,(H3,16,17) |
| InChIKey | OQFBFYMCQRYWIT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|