About 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline
2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline (PubChem CID 82448488) has the molecular formula C16H20ClN
and a molecular weight of 261.80 g/mol. Its IUPAC name is 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline.
Molecular Properties
| Compound Name | 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline |
| PubChem CID | 82448488 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline |
| SMILES | Cc1ccc2c(CCl)cc(C(C)(C)C)nc2c1C |
| InChI | InChI=1S/C16H20ClN/c1-10-6-7-13-12(9-17)8-14(16(3,4)5)18-15(13)11(10)2/h6-8H,9H2,1-5H3 |
| InChIKey | LZPUUYVZGSLYKH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline?
The IUPAC name of 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline (CID 82448488) is 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline.
What is the SMILES notation for 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline?
The canonical SMILES for 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline is Cc1ccc2c(CCl)cc(C(C)(C)C)nc2c1C.
What is the InChIKey of 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline?
The InChIKey is LZPUUYVZGSLYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN/c1-10-6-7-13-12(9-17)8-14(16(3,4)5)18-15(13)11(10)2/h6-8H,9H2,1-5H3.
What are the key properties of 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline?
2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline has a molecular weight of 261.80 g/mol, XLogP of 4.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-(chloromethyl)-7,8-dimethylquinoline is sourced from PubChem (CID 82448488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).