About 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide
2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide (PubChem CID 82448500) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide.
Molecular Properties
| Compound Name | 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide |
| PubChem CID | 82448500 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide |
| SMILES | Cc1ccc2c(C(=O)NN)cc(C(C)(C)C)nc2c1C |
| InChI | InChI=1S/C16H21N3O/c1-9-6-7-11-12(15(20)19-17)8-13(16(3,4)5)18-14(11)10(9)2/h6-8H,17H2,1-5H3,(H,19,20) |
| InChIKey | OTZFGSABSIBUIY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide?
The IUPAC name of 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide (CID 82448500) is 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide.
What is the SMILES notation for 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide?
The canonical SMILES for 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide is Cc1ccc2c(C(=O)NN)cc(C(C)(C)C)nc2c1C.
What is the InChIKey of 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide?
The InChIKey is OTZFGSABSIBUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-9-6-7-11-12(15(20)19-17)8-13(16(3,4)5)18-14(11)10(9)2/h6-8H,17H2,1-5H3,(H,19,20).
What are the key properties of 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide?
2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide has a molecular weight of 271.36 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-7,8-dimethylquinoline-4-carbohydrazide is sourced from PubChem (CID 82448500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).