C15H15NO2 — CID 82448534
(E)-3-(2,6,8-trimethylquinolin-4-yl)prop-2-enoic acid (PubChem CID 82448534) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (E)-3-(2,6,8-trimethylquinolin-4-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,6,8-trimethylquinolin-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82448534 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (E)-3-(2,6,8-trimethylquinolin-4-yl)prop-2-enoic acid |
| SMILES | Cc1cc(C)c2nc(C)cc(/C=C/C(=O)O)c2c1 |
| InChI | InChI=1S/C15H15NO2/c1-9-6-10(2)15-13(7-9)12(4-5-14(17)18)8-11(3)16-15/h4-8H,1-3H3,(H,17,18)/b5-4+ |
| InChIKey | BRJMTCIWSSMMEF-SNAWJCMRSA-N |
| XLogP | 3.26 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|