C16H17N3OS — CID 82448568
5-(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82448568) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82448568 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-(6,8-dimethyl-2-propan-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1cc(C)c2nc(C(C)C)cc(-c3n[nH]c(=S)o3)c2c1 |
| InChI | InChI=1S/C16H17N3OS/c1-8(2)13-7-12(15-18-19-16(21)20-15)11-6-9(3)5-10(4)14(11)17-13/h5-8H,1-4H3,(H,19,21) |
| InChIKey | ANVBXVMGUFIKGG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|