About (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine
(2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine (PubChem CID 82448590) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine.
Molecular Properties
| Compound Name | (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine |
| PubChem CID | 82448590 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine |
| SMILES | Cc1cc(C)c2nc(C(C)(C)C)cc(CN)c2c1 |
| InChI | InChI=1S/C16H22N2/c1-10-6-11(2)15-13(7-10)12(9-17)8-14(18-15)16(3,4)5/h6-8H,9,17H2,1-5H3 |
| InChIKey | DZZLGPPKTOCRSW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine?
The IUPAC name of (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine (CID 82448590) is (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine.
What is the SMILES notation for (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine?
The canonical SMILES for (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine is Cc1cc(C)c2nc(C(C)(C)C)cc(CN)c2c1.
What is the InChIKey of (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine?
The InChIKey is DZZLGPPKTOCRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-10-6-11(2)15-13(7-10)12(9-17)8-14(18-15)16(3,4)5/h6-8H,9,17H2,1-5H3.
What are the key properties of (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine?
(2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine has a molecular weight of 242.37 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-6,8-dimethylquinolin-4-yl)methanamine is sourced from PubChem (CID 82448590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).