C17H22N4O — CID 82450209
2,6-diethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbohydrazide (PubChem CID 82450209) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 2,6-diethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbohydrazide.
| Compound Name | 2,6-diethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbohydrazide |
|---|---|
| PubChem CID | 82450209 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2,6-diethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carbohydrazide |
| SMILES | CCc1cccc2c(C(=O)NN)c3c(nc12)CCN(CC)C3 |
| InChI | InChI=1S/C17H22N4O/c1-3-11-6-5-7-12-15(17(22)20-18)13-10-21(4-2)9-8-14(13)19-16(11)12/h5-7H,3-4,8-10,18H2,1-2H3,(H,20,22) |
| InChIKey | YXMKEOYDLOVSAJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|