About N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine
N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine (PubChem CID 82450215) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine |
| PubChem CID | 82450215 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine |
| SMILES | CCNCc1c2c(nc3c(C(C)C)cccc13)CCC2 |
| InChI | InChI=1S/C18H24N2/c1-4-19-11-16-14-8-6-10-17(14)20-18-13(12(2)3)7-5-9-15(16)18/h5,7,9,12,19H,4,6,8,10-11H2,1-3H3 |
| InChIKey | BPCQBKHFDMTLTN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine?
The IUPAC name of N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine (CID 82450215) is N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine.
What is the SMILES notation for N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine?
The canonical SMILES for N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine is CCNCc1c2c(nc3c(C(C)C)cccc13)CCC2.
What is the InChIKey of N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine?
The InChIKey is BPCQBKHFDMTLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2/c1-4-19-11-16-14-8-6-10-17(14)20-18-13(12(2)3)7-5-9-15(16)18/h5,7,9,12,19H,4,6,8,10-11H2,1-3H3.
What are the key properties of N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine?
N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine has a molecular weight of 268.40 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-propan-2-yl-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methyl]ethanamine is sourced from PubChem (CID 82450215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).