About N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine
N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine (PubChem CID 82451155) has the molecular formula C18H24FN3
and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine |
| PubChem CID | 82451155 |
| Molecular Formula | C18H24FN3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1c2c(nc3c(F)cccc13)CCN(CC)C2 |
| InChI | InChI=1S/C18H24FN3/c1-3-9-20-11-14-13-6-5-7-16(19)18(13)21-17-8-10-22(4-2)12-15(14)17/h5-7,20H,3-4,8-12H2,1-2H3 |
| InChIKey | MUORQMKFJAMTLL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine?
The IUPAC name of N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine (CID 82451155) is N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine is CCCNCc1c2c(nc3c(F)cccc13)CCN(CC)C2.
What is the InChIKey of N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine?
The InChIKey is MUORQMKFJAMTLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24FN3/c1-3-9-20-11-14-13-6-5-7-16(19)18(13)21-17-8-10-22(4-2)12-15(14)17/h5-7,20H,3-4,8-12H2,1-2H3.
What are the key properties of N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine?
N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine has a molecular weight of 301.41 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethyl-6-fluoro-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)methyl]propan-1-amine is sourced from PubChem (CID 82451155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).