C11H15BrN2 — CID 82452342
3-(bromomethyl)-2,6-dimethyl-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 82452342) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 3-(bromomethyl)-2,6-dimethyl-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 3-(bromomethyl)-2,6-dimethyl-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 82452342 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-(bromomethyl)-2,6-dimethyl-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | Cc1nc2c(cc1CBr)CN(C)CC2 |
| InChI | InChI=1S/C11H15BrN2/c1-8-9(6-12)5-10-7-14(2)4-3-11(10)13-8/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | NTYOPXJUGKIGKG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|