C13H16N4OS — CID 82452409
5-(6-ethyl-2-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82452409) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 5-(6-ethyl-2-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(6-ethyl-2-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82452409 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(6-ethyl-2-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCN1CCc2nc(C)c(-c3n[nH]c(=S)o3)cc2C1 |
| InChI | InChI=1S/C13H16N4OS/c1-3-17-5-4-11-9(7-17)6-10(8(2)14-11)12-15-16-13(19)18-12/h6H,3-5,7H2,1-2H3,(H,16,19) |
| InChIKey | KTCPVMRREOESPA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|