C14H23N3O — CID 82454018
N-cyclohexyl-2-methyl-6-propoxypyrimidin-4-amine (PubChem CID 82454018) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-cyclohexyl-2-methyl-6-propoxypyrimidin-4-amine.
| Compound Name | N-cyclohexyl-2-methyl-6-propoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 82454018 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-cyclohexyl-2-methyl-6-propoxypyrimidin-4-amine |
| SMILES | CCCOc1cc(NC2CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C14H23N3O/c1-3-9-18-14-10-13(15-11(2)16-14)17-12-7-5-4-6-8-12/h10,12H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | ZAFJZXIVNMDTEJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |