C16H24O3 — CID 824547
(4aR,8aS)-3-(1,3-dioxolan-2-yl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 824547) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (4aR,8aS)-3-(1,3-dioxolan-2-yl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aR,8aS)-3-(1,3-dioxolan-2-yl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 824547 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (4aR,8aS)-3-(1,3-dioxolan-2-yl)-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC1(C)CCC[C@]2(C)C=C(C3OCCO3)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C16H24O3/c1-15(2)5-4-6-16(3)10-11(12(17)9-13(15)16)14-18-7-8-19-14/h10,13-14H,4-9H2,1-3H3/t13-,16+/m0/s1 |
| InChIKey | MSVIYUOUFVKLEG-XJKSGUPXSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |