C17H24N4O — CID 82455686
2-ethyl-4-N-(1-phenylethyl)-6-propoxypyrimidine-4,5-diamine (PubChem CID 82455686) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-ethyl-4-N-(1-phenylethyl)-6-propoxypyrimidine-4,5-diamine.
| Compound Name | 2-ethyl-4-N-(1-phenylethyl)-6-propoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455686 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-ethyl-4-N-(1-phenylethyl)-6-propoxypyrimidine-4,5-diamine |
| SMILES | CCCOc1nc(CC)nc(NC(C)c2ccccc2)c1N |
| InChI | InChI=1S/C17H24N4O/c1-4-11-22-17-15(18)16(20-14(5-2)21-17)19-12(3)13-9-7-6-8-10-13/h6-10,12H,4-5,11,18H2,1-3H3,(H,19,20,21) |
| InChIKey | BBGOOKSJGIKHAF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |