C13H24N4O3 — CID 82456161
6-(2-methoxyethoxy)-4-N-(2-methoxyethyl)-2-propylpyrimidine-4,5-diamine (PubChem CID 82456161) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-4-N-(2-methoxyethyl)-2-propylpyrimidine-4,5-diamine.
| Compound Name | 6-(2-methoxyethoxy)-4-N-(2-methoxyethyl)-2-propylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82456161 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 6-(2-methoxyethoxy)-4-N-(2-methoxyethyl)-2-propylpyrimidine-4,5-diamine |
| SMILES | CCCc1nc(NCCOC)c(N)c(OCCOC)n1 |
| InChI | InChI=1S/C13H24N4O3/c1-4-5-10-16-12(15-6-7-18-2)11(14)13(17-10)20-9-8-19-3/h4-9,14H2,1-3H3,(H,15,16,17) |
| InChIKey | WJIBEZJDXAUWAZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|