C11H16N4O — CID 82456171
4-N,2-dicyclopropyl-6-methoxypyrimidine-4,5-diamine (PubChem CID 82456171) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 4-N,2-dicyclopropyl-6-methoxypyrimidine-4,5-diamine.
| Compound Name | 4-N,2-dicyclopropyl-6-methoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82456171 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 4-N,2-dicyclopropyl-6-methoxypyrimidine-4,5-diamine |
| SMILES | COc1nc(C2CC2)nc(NC2CC2)c1N |
| InChI | InChI=1S/C11H16N4O/c1-16-11-8(12)10(13-7-4-5-7)14-9(15-11)6-2-3-6/h6-7H,2-5,12H2,1H3,(H,13,14,15) |
| InChIKey | MECCTWBTUWJTFX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |