About 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine
4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine (PubChem CID 82456251) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine |
| PubChem CID | 82456251 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine |
| SMILES | CCOc1nc(C2CC2)nc(NCc2ccccc2)c1N |
| InChI | InChI=1S/C16H20N4O/c1-2-21-16-13(17)15(19-14(20-16)12-8-9-12)18-10-11-6-4-3-5-7-11/h3-7,12H,2,8-10,17H2,1H3,(H,18,19,20) |
| InChIKey | CGDVBYGOEBIKPS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine?
The IUPAC name of 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine (CID 82456251) is 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine.
What is the SMILES notation for 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine?
The canonical SMILES for 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine is CCOc1nc(C2CC2)nc(NCc2ccccc2)c1N.
What is the InChIKey of 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine?
The InChIKey is CGDVBYGOEBIKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-2-21-16-13(17)15(19-14(20-16)12-8-9-12)18-10-11-6-4-3-5-7-11/h3-7,12H,2,8-10,17H2,1H3,(H,18,19,20).
What are the key properties of 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine?
4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine has a molecular weight of 284.36 g/mol, XLogP of 2.95, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-benzyl-2-cyclopropyl-6-ethoxypyrimidine-4,5-diamine is sourced from PubChem (CID 82456251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).