C15H26N4O — CID 82456312
6-butoxy-4-N-tert-butyl-2-cyclopropylpyrimidine-4,5-diamine (PubChem CID 82456312) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 6-butoxy-4-N-tert-butyl-2-cyclopropylpyrimidine-4,5-diamine.
| Compound Name | 6-butoxy-4-N-tert-butyl-2-cyclopropylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82456312 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 6-butoxy-4-N-tert-butyl-2-cyclopropylpyrimidine-4,5-diamine |
| SMILES | CCCCOc1nc(C2CC2)nc(NC(C)(C)C)c1N |
| InChI | InChI=1S/C15H26N4O/c1-5-6-9-20-14-11(16)13(19-15(2,3)4)17-12(18-14)10-7-8-10/h10H,5-9,16H2,1-4H3,(H,17,18,19) |
| InChIKey | TYUSPTYFOZPXDO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|