C8H13N3S — CID 82457112
6-(2-methylpropylamino)-1H-pyrimidine-4-thione (PubChem CID 82457112) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 6-(2-methylpropylamino)-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-methylpropylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457112 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 6-(2-methylpropylamino)-1H-pyrimidine-4-thione |
| SMILES | CC(C)CNc1cc(=S)nc[nH]1 |
| InChI | InChI=1S/C8H13N3S/c1-6(2)4-9-7-3-8(12)11-5-10-7/h3,5-6H,4H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | ZXFCBEUHSYNCMI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|