C14H24N4S — CID 82457148
2-methyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione (PubChem CID 82457148) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-methyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione.
| Compound Name | 2-methyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457148 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-methyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)cc(NC2CC(C)(C)NC(C)(C)C2)[nH]1 |
| InChI | InChI=1S/C14H24N4S/c1-9-15-11(6-12(19)16-9)17-10-7-13(2,3)18-14(4,5)8-10/h6,10,18H,7-8H2,1-5H3,(H2,15,16,17,19) |
| InChIKey | DODIEPJJEBNALB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|