C16H28N4S — CID 82457272
2-propan-2-yl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione (PubChem CID 82457272) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is 2-propan-2-yl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione.
| Compound Name | 2-propan-2-yl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457272 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-propan-2-yl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1nc(=S)cc(NC2CC(C)(C)NC(C)(C)C2)[nH]1 |
| InChI | InChI=1S/C16H28N4S/c1-10(2)14-18-12(7-13(21)19-14)17-11-8-15(3,4)20-16(5,6)9-11/h7,10-11,20H,8-9H2,1-6H3,(H2,17,18,19,21) |
| InChIKey | RILOARNZYYEMQU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|