C16H28N4S — CID 82457329
2-propyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione (PubChem CID 82457329) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is 2-propyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione.
| Compound Name | 2-propyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457329 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-propyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
| SMILES | CCCc1nc(=S)cc(NC2CC(C)(C)NC(C)(C)C2)[nH]1 |
| InChI | InChI=1S/C16H28N4S/c1-6-7-12-18-13(8-14(21)19-12)17-11-9-15(2,3)20-16(4,5)10-11/h8,11,20H,6-7,9-10H2,1-5H3,(H2,17,18,19,21) |
| InChIKey | KOMYTURYDZJYPT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|