C10H17N3OS — CID 82457419
2-tert-butyl-6-(2-hydroxyethylamino)-1H-pyrimidine-4-thione (PubChem CID 82457419) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-tert-butyl-6-(2-hydroxyethylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-tert-butyl-6-(2-hydroxyethylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457419 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-tert-butyl-6-(2-hydroxyethylamino)-1H-pyrimidine-4-thione |
| SMILES | CC(C)(C)c1nc(=S)cc(NCCO)[nH]1 |
| InChI | InChI=1S/C10H17N3OS/c1-10(2,3)9-12-7(11-4-5-14)6-8(15)13-9/h6,14H,4-5H2,1-3H3,(H2,11,12,13,15) |
| InChIKey | KXAUINPCPDUHRU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|